C22H30O3 — CID 57257912
[2-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)cyclohexyl] formate (PubChem CID 57257912) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [2-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)cyclohexyl] formate.
| Compound Name | [2-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)cyclohexyl] formate |
|---|---|
| PubChem CID | 57257912 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [2-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)cyclohexyl] formate |
| SMILES | CC1C(C)(C)c2ccc(C(=O)C3CCCCC3OC=O)cc2C1(C)C |
| InChI | InChI=1S/C22H30O3/c1-14-21(2,3)17-11-10-15(12-18(17)22(14,4)5)20(24)16-8-6-7-9-19(16)25-13-23/h10-14,16,19H,6-9H2,1-5H3 |
| InChIKey | NNPJSIKVIDPFNY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|