C19H20O6 — CID 57258081
methyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 57258081) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is methyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | methyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 57258081 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | COC(=O)C=CC=CC=CC=CC1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C19H20O6/c1-13-14(17(22)19(25-4)18(24-3)16(13)21)11-9-7-5-6-8-10-12-15(20)23-2/h5-12H,1-4H3 |
| InChIKey | RMSPNVXGGNNSFW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|