C45H73NO11 — CID 57258267
17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-propan-2-yloxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone (PubChem CID 57258267) has the molecular formula C45H73NO11 and a molecular weight of 804.07 g/mol. Its IUPAC name is 17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-propan-2-yloxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone.
| Compound Name | 17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-propan-2-yloxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
|---|---|
| PubChem CID | 57258267 |
| Molecular Formula | C45H73NO11 |
| Molecular Weight | 804.07 g/mol |
| Exact Mass | 803.52 |
| IUPAC Name | 17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-propan-2-yloxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
| SMILES | CCC1C=C(C)CC(C)CC(OC)C2OC(O)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C)=CC3CCC(O)C(OC(C)C)C3)C(C)CCC1=O)C(C)CC2OC |
| InChI | InChI=1S/C45H73NO11/c1-11-33-21-27(4)20-28(5)22-38(53-9)41-39(54-10)24-31(8)45(52,57-41)42(49)43(50)46-19-13-12-14-34(46)44(51)56-40(29(6)15-17-35(33)47)30(7)23-32-16-18-36(48)37(25-32)55-26(2)3/h21,23,26,28-29,31-34,36-41,48,52H,11-20,22,24-25H2,1-10H3 |
| InChIKey | SNVLHLPSHKNKRZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.07 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|