C23H40O5 — CID 57258313
methyl 7-[(2R,3R,5S)-2-(8-hydroxyoct-1-enyl)-3,5-dimethoxycyclopentyl]hept-2-enoate (PubChem CID 57258313) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is methyl 7-[(2R,3R,5S)-2-(8-hydroxyoct-1-enyl)-3,5-dimethoxycyclopentyl]hept-2-enoate.
| Compound Name | methyl 7-[(2R,3R,5S)-2-(8-hydroxyoct-1-enyl)-3,5-dimethoxycyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57258313 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | methyl 7-[(2R,3R,5S)-2-(8-hydroxyoct-1-enyl)-3,5-dimethoxycyclopentyl]hept-2-enoate |
| SMILES | COC(=O)C=CCCCCC1[C@@H](OC)C[C@@H](OC)[C@@H]1C=CCCCCCCO |
| InChI | InChI=1S/C23H40O5/c1-26-21-18-22(27-2)20(15-11-7-8-12-16-23(25)28-3)19(21)14-10-6-4-5-9-13-17-24/h10,12,14,16,19-22,24H,4-9,11,13,15,17-18H2,1-3H3/t19-,20?,21-,22+/m1/s1 |
| InChIKey | ISXHNSHMZWCAAN-XCSKNGGISA-N |
| XLogP | 4.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|