About methyl (1-phenylethenylamino) carbonate
methyl (1-phenylethenylamino) carbonate (PubChem CID 57258600) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl (1-phenylethenylamino) carbonate.
Molecular Properties
| Compound Name | methyl (1-phenylethenylamino) carbonate |
| PubChem CID | 57258600 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methyl (1-phenylethenylamino) carbonate |
| SMILES | C=C(NOC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c1-8(11-14-10(12)13-2)9-6-4-3-5-7-9/h3-7,11H,1H2,2H3 |
| InChIKey | MXDKCLAZZUCEPR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (1-phenylethenylamino) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1-phenylethenylamino) carbonate?
The IUPAC name of methyl (1-phenylethenylamino) carbonate (CID 57258600) is methyl (1-phenylethenylamino) carbonate.
What is the SMILES notation for methyl (1-phenylethenylamino) carbonate?
The canonical SMILES for methyl (1-phenylethenylamino) carbonate is C=C(NOC(=O)OC)c1ccccc1.
What is the InChIKey of methyl (1-phenylethenylamino) carbonate?
The InChIKey is MXDKCLAZZUCEPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-8(11-14-10(12)13-2)9-6-4-3-5-7-9/h3-7,11H,1H2,2H3.
What are the key properties of methyl (1-phenylethenylamino) carbonate?
methyl (1-phenylethenylamino) carbonate has a molecular weight of 193.20 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1-phenylethenylamino) carbonate is sourced from PubChem (CID 57258600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).