C35H42N2O2P2S — CID 57258921
(2S,4S)-4-bis(4-methylphenyl)phosphanyl-2-[bis(4-methylphenyl)phosphanylmethyl]-N,N-dimethylpyrrolidine-1-sulfonamide (PubChem CID 57258921) has the molecular formula C35H42N2O2P2S and a molecular weight of 616.75 g/mol. Its IUPAC name is (2S,4S)-4-bis(4-methylphenyl)phosphanyl-2-[bis(4-methylphenyl)phosphanylmethyl]-N,N-dimethylpyrrolidine-1-sulfonamide.
| Compound Name | (2S,4S)-4-bis(4-methylphenyl)phosphanyl-2-[bis(4-methylphenyl)phosphanylmethyl]-N,N-dimethylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 57258921 |
| Molecular Formula | C35H42N2O2P2S |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | (2S,4S)-4-bis(4-methylphenyl)phosphanyl-2-[bis(4-methylphenyl)phosphanylmethyl]-N,N-dimethylpyrrolidine-1-sulfonamide |
| SMILES | Cc1ccc(P(C[C@@H]2C[C@H](P(c3ccc(C)cc3)c3ccc(C)cc3)CN2S(=O)(=O)N(C)C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H42N2O2P2S/c1-26-7-15-31(16-8-26)40(32-17-9-27(2)10-18-32)25-30-23-35(24-37(30)42(38,39)36(5)6)41(33-19-11-28(3)12-20-33)34-21-13-29(4)14-22-34/h7-22,30,35H,23-25H2,1-6H3/t30-,35-/m0/s1 |
| InChIKey | VOGYHRZZQCXMBZ-QGRQJHSQSA-N |
| XLogP | 5.74 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|