C22H25N5O6 — CID 57259187
1-(3,4,5-trimethoxyphenyl)-N-[3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-yl]methanimine (PubChem CID 57259187) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-N-[3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-yl]methanimine.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-N-[3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-yl]methanimine |
|---|---|
| PubChem CID | 57259187 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-N-[3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-yl]methanimine |
| SMILES | COc1cc(C=Nc2n[nH]c(N=Cc3cc(OC)c(OC)c(OC)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N5O6/c1-28-15-7-13(8-16(29-2)19(15)32-5)11-23-21-25-22(27-26-21)24-12-14-9-17(30-3)20(33-6)18(10-14)31-4/h7-12H,1-6H3,(H,25,26,27) |
| InChIKey | LPAWRIAMLKGYBA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|