C26H40F2O6 — CID 57259379
methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooct-2-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate (PubChem CID 57259379) has the molecular formula C26H40F2O6 and a molecular weight of 486.60 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooct-2-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooct-2-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 57259379 |
| Molecular Formula | C26H40F2O6 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooct-2-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCC(F)(F)C(=O)C=CC[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C26H40F2O6/c1-3-16-26(27,28)23(30)13-10-12-20-19(11-6-4-5-7-14-24(31)32-2)21(29)18-22(20)34-25-15-8-9-17-33-25/h10,13,19-20,22,25H,3-9,11-12,14-18H2,1-2H3/t19-,20-,22-,25?/m1/s1 |
| InChIKey | RFMRKWHFVPJMMH-OKXUMRAKSA-N |
| XLogP | 5.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|