About 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine
2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine (PubChem CID 57259403) has the molecular formula C12H24N2S
and a molecular weight of 228.41 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine |
| PubChem CID | 57259403 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine |
| SMILES | CCN(C=CSC=CN(CC)CC)CC |
| InChI | InChI=1S/C12H24N2S/c1-5-13(6-2)9-11-15-12-10-14(7-3)8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | OHAKSDPLXLHPMF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine?
The IUPAC name of 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine (CID 57259403) is 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine.
What is the SMILES notation for 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine?
The canonical SMILES for 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine is CCN(C=CSC=CN(CC)CC)CC.
What is the InChIKey of 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine?
The InChIKey is OHAKSDPLXLHPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2S/c1-5-13(6-2)9-11-15-12-10-14(7-3)8-4/h9-12H,5-8H2,1-4H3.
What are the key properties of 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine?
2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine has a molecular weight of 228.41 g/mol, XLogP of 3.35, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethenylsulfanyl]-N,N-diethylethenamine is sourced from PubChem (CID 57259403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).