C14H20N2O — CID 57259590
1-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 57259590) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | 1-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 57259590 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CC(C)(C)C1NC(C(N)=O)Cc2ccccc21 |
| InChI | InChI=1S/C14H20N2O/c1-14(2,3)12-10-7-5-4-6-9(10)8-11(16-12)13(15)17/h4-7,11-12,16H,8H2,1-3H3,(H2,15,17) |
| InChIKey | OCTRISKSYHLRII-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |