C31H58ClN7O2 — CID 57259604
6-chloro-2-N,4-N-bis[3-ethoxy-3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]-1,3,5-triazine-2,4-diamine (PubChem CID 57259604) has the molecular formula C31H58ClN7O2 and a molecular weight of 596.31 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis[3-ethoxy-3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis[3-ethoxy-3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 57259604 |
| Molecular Formula | C31H58ClN7O2 |
| Molecular Weight | 596.31 g/mol |
| Exact Mass | 595.43 |
| IUPAC Name | 6-chloro-2-N,4-N-bis[3-ethoxy-3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCOC(CCNc1nc(Cl)nc(NCCC(OCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C31H58ClN7O2/c1-11-40-23(21-17-28(3,4)38-29(5,6)18-21)13-15-33-26-35-25(32)36-27(37-26)34-16-14-24(41-12-2)22-19-30(7,8)39-31(9,10)20-22/h21-24,38-39H,11-20H2,1-10H3,(H2,33,34,35,36,37) |
| InChIKey | LLWUCNSYKFKLIS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.31 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |