C32H62O2Si2 — CID 57260753
tert-butyl-dimethyl-[7-[(1R)-2-octyl-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoxy]silane (PubChem CID 57260753) has the molecular formula C32H62O2Si2 and a molecular weight of 535.02 g/mol. Its IUPAC name is tert-butyl-dimethyl-[7-[(1R)-2-octyl-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[7-[(1R)-2-octyl-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoxy]silane |
|---|---|
| PubChem CID | 57260753 |
| Molecular Formula | C32H62O2Si2 |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 534.43 |
| IUPAC Name | tert-butyl-dimethyl-[7-[(1R)-2-octyl-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoxy]silane |
| SMILES | CCCCCCCCC1=CCC(O[Si](CC)(CC)CC)[C@@H]1CCC=C=CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H62O2Si2/c1-10-14-15-16-18-21-24-29-26-27-31(34-36(11-2,12-3)13-4)30(29)25-22-19-17-20-23-28-33-35(8,9)32(5,6)7/h19-20,26,30-31H,10-16,18,21-25,27-28H2,1-9H3/t17?,30-,31?/m1/s1 |
| InChIKey | IZCFZVXLSBKUJS-CNNVQYEPSA-N |
| XLogP | 10.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|