C26H44N6 — CID 57260839
2,3,10,11,13,19-hexamethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1,11,13,18,20,25-hexaene (PubChem CID 57260839) has the molecular formula C26H44N6 and a molecular weight of 440.68 g/mol. Its IUPAC name is 2,3,10,11,13,19-hexamethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1,11,13,18,20,25-hexaene.
| Compound Name | 2,3,10,11,13,19-hexamethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1,11,13,18,20,25-hexaene |
|---|---|
| PubChem CID | 57260839 |
| Molecular Formula | C26H44N6 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.36 |
| IUPAC Name | 2,3,10,11,13,19-hexamethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1,11,13,18,20,25-hexaene |
| SMILES | CC1=C2/C=N\CCC/N=C/C(=C(C)N(C)CCCCCCN1C)/C(C)=N/CCC/N=C\2C |
| InChI | InChI=1S/C26H44N6/c1-21-25-19-27-13-11-14-28-20-26(22(2)30-16-12-15-29-21)24(4)32(6)18-10-8-7-9-17-31(5)23(25)3/h19-20H,7-18H2,1-6H3/b25-23?,26-24?,27-19-,28-20+,29-21-,30-22+ |
| InChIKey | BKFGCMHSWXPLQA-OFYPSATJSA-N |
| XLogP | 4.83 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |