C18H34N3O4+ — CID 57260908
tert-butyl (2S,4S)-1-tert-butyl-2-carbamoyl-4-morpholin-4-ylpyrrolidin-1-ium-1-carboxylate (PubChem CID 57260908) has the molecular formula C18H34N3O4+ and a molecular weight of 356.49 g/mol. Its IUPAC name is tert-butyl (2S,4S)-1-tert-butyl-2-carbamoyl-4-morpholin-4-ylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-1-tert-butyl-2-carbamoyl-4-morpholin-4-ylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57260908 |
| Molecular Formula | C18H34N3O4+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tert-butyl (2S,4S)-1-tert-butyl-2-carbamoyl-4-morpholin-4-ylpyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(C(C)(C)C)C[C@@H](N2CCOCC2)C[C@H]1C(N)=O |
| InChI | InChI=1S/C18H33N3O4/c1-17(2,3)21(16(23)25-18(4,5)6)12-13(11-14(21)15(19)22)20-7-9-24-10-8-20/h13-14H,7-12H2,1-6H3,(H-,19,22)/p+1/t13-,14-,21?/m0/s1 |
| InChIKey | LTWGPPJGSAKIME-CFMHULJUSA-O |
| XLogP | 1.50 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|