C25H42N2O5Si — CID 57261052
prop-2-enyl 2-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]piperidine-1-carboxylate (PubChem CID 57261052) has the molecular formula C25H42N2O5Si and a molecular weight of 478.71 g/mol. Its IUPAC name is prop-2-enyl 2-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]piperidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57261052 |
| Molecular Formula | C25H42N2O5Si |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | prop-2-enyl 2-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCCCC1C=C(C)C(=O)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42N2O5Si/c1-9-14-31-24(30)27-13-11-10-12-19(27)15-17(2)21(28)16-20-22(23(29)26-20)18(3)32-33(7,8)25(4,5)6/h9,15,18-20,22H,1,10-14,16H2,2-8H3,(H,26,29)/t18-,19?,20-,22-/m1/s1 |
| InChIKey | BOXOTHVYERUFSW-YNVZICNDSA-N |
| XLogP | 4.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|