C40H64N2O5Si — CID 57261199
tert-butyl N-[(5S,6S,8R)-8-(butylcarbamoyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-3,3-dimethyldodec-10-en-5-yl]carbamate (PubChem CID 57261199) has the molecular formula C40H64N2O5Si and a molecular weight of 681.05 g/mol. Its IUPAC name is tert-butyl N-[(5S,6S,8R)-8-(butylcarbamoyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-3,3-dimethyldodec-10-en-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5S,6S,8R)-8-(butylcarbamoyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-3,3-dimethyldodec-10-en-5-yl]carbamate |
|---|---|
| PubChem CID | 57261199 |
| Molecular Formula | C40H64N2O5Si |
| Molecular Weight | 681.05 g/mol |
| Exact Mass | 680.46 |
| IUPAC Name | tert-butyl N-[(5S,6S,8R)-8-(butylcarbamoyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-3,3-dimethyldodec-10-en-5-yl]carbamate |
| SMILES | CC=CC[C@H](C[C@H](O)[C@H](CC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)C(=O)NCCCC |
| InChI | InChI=1S/C40H64N2O5Si/c1-11-13-21-31(36(44)41-27-14-12-2)29-35(43)34(42-37(45)47-38(3,4)5)30-40(9,10)26-28-46-48(39(6,7)8,32-22-17-15-18-23-32)33-24-19-16-20-25-33/h11,13,15-20,22-25,31,34-35,43H,12,14,21,26-30H2,1-10H3,(H,41,44)(H,42,45)/t31-,34+,35+/m1/s1 |
| InChIKey | INGRFBHGGPKILX-ZMAQEQNXSA-N |
| XLogP | 7.51 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.05 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|