About (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine
(6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 57261366) has the molecular formula C20H24N2O
and a molecular weight of 308.43 g/mol. Its IUPAC name is (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine.
Molecular Properties
| Compound Name | (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine |
| PubChem CID | 57261366 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | CONC1=C[C@@H](Cc2ccccc2)N(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2O/c1-23-21-19-12-13-22(16-18-10-6-3-7-11-18)20(15-19)14-17-8-4-2-5-9-17/h2-11,15,20-21H,12-14,16H2,1H3/t20-/m1/s1 |
| InChIKey | YQWKUNGALVSGEK-HXUWFJFHSA-N |
| XLogP | 3.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine?
The IUPAC name of (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine (CID 57261366) is (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine.
What is the SMILES notation for (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine?
The canonical SMILES for (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine is CONC1=C[C@@H](Cc2ccccc2)N(Cc2ccccc2)CC1.
What is the InChIKey of (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine?
The InChIKey is YQWKUNGALVSGEK-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H24N2O/c1-23-21-19-12-13-22(16-18-10-6-3-7-11-18)20(15-19)14-17-8-4-2-5-9-17/h2-11,15,20-21H,12-14,16H2,1H3/t20-/m1/s1.
What are the key properties of (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine?
(6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine has a molecular weight of 308.43 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1,6-dibenzyl-N-methoxy-3,6-dihydro-2H-pyridin-4-amine is sourced from PubChem (CID 57261366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).