About 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine
2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine (PubChem CID 57261654) has the molecular formula C18H42N4O3
and a molecular weight of 362.56 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine |
| PubChem CID | 57261654 |
| Molecular Formula | C18H42N4O3 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.33 |
| IUPAC Name | 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine |
| SMILES | CC(CN(CC(C)OCCCN)CC(C)OCCCN)OCCCN |
| InChI | InChI=1S/C18H42N4O3/c1-16(23-10-4-7-19)13-22(14-17(2)24-11-5-8-20)15-18(3)25-12-6-9-21/h16-18H,4-15,19-21H2,1-3H3 |
| InChIKey | IHHBRRVRSYODAV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine?
The IUPAC name of 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine (CID 57261654) is 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine.
What is the SMILES notation for 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine?
The canonical SMILES for 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine is CC(CN(CC(C)OCCCN)CC(C)OCCCN)OCCCN.
What is the InChIKey of 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine?
The InChIKey is IHHBRRVRSYODAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H42N4O3/c1-16(23-10-4-7-19)13-22(14-17(2)24-11-5-8-20)15-18(3)25-12-6-9-21/h16-18H,4-15,19-21H2,1-3H3.
What are the key properties of 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine?
2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine has a molecular weight of 362.56 g/mol, XLogP of 0.55, 18 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopropoxy)-N,N-bis[2-(3-aminopropoxy)propyl]propan-1-amine is sourced from PubChem (CID 57261654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).