About 3-azatricyclo[7.3.1.03,7]tridecane
3-azatricyclo[7.3.1.03,7]tridecane (PubChem CID 57261667) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 3-azatricyclo[7.3.1.03,7]tridecane.
Molecular Properties
| Compound Name | 3-azatricyclo[7.3.1.03,7]tridecane |
| PubChem CID | 57261667 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3-azatricyclo[7.3.1.03,7]tridecane |
| SMILES | C1CC2CC(C1)CN1CCCC1C2 |
| InChI | InChI=1S/C12H21N/c1-3-10-7-11(4-1)9-13-6-2-5-12(13)8-10/h10-12H,1-9H2 |
| InChIKey | QOIORCBOPZDXTQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-azatricyclo[7.3.1.03,7]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azatricyclo[7.3.1.03,7]tridecane?
The IUPAC name of 3-azatricyclo[7.3.1.03,7]tridecane (CID 57261667) is 3-azatricyclo[7.3.1.03,7]tridecane.
What is the SMILES notation for 3-azatricyclo[7.3.1.03,7]tridecane?
The canonical SMILES for 3-azatricyclo[7.3.1.03,7]tridecane is C1CC2CC(C1)CN1CCCC1C2.
What is the InChIKey of 3-azatricyclo[7.3.1.03,7]tridecane?
The InChIKey is QOIORCBOPZDXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-3-10-7-11(4-1)9-13-6-2-5-12(13)8-10/h10-12H,1-9H2.
What are the key properties of 3-azatricyclo[7.3.1.03,7]tridecane?
3-azatricyclo[7.3.1.03,7]tridecane has a molecular weight of 179.31 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azatricyclo[7.3.1.03,7]tridecane is sourced from PubChem (CID 57261667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).