C23H27N5O3 — CID 57261739
N-[[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-methoxymethyl]-5-nitropyridin-2-amine (PubChem CID 57261739) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-methoxymethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-methoxymethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 57261739 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-methoxymethyl]-5-nitropyridin-2-amine |
| SMILES | COC(Nc1ccc([N+](=O)[O-])cn1)[C@@H]1CC2c3cccc4c3c(cn4C)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C23H27N5O3/c1-26-12-14-10-20-18(17-5-4-6-19(26)22(14)17)9-15(13-27(20)2)23(31-3)25-21-8-7-16(11-24-21)28(29)30/h4-8,11-12,15,18,20,23H,9-10,13H2,1-3H3,(H,24,25)/t15-,18?,20-,23?/m1/s1 |
| InChIKey | SBEFUWJLNDZFIQ-OTJZQNOXSA-N |
| XLogP | 3.53 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|