2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid

C20H16N2O3 — CID 57261742

IUPAC2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid
SMILESNc1ccc2c(c1)Oc1cc(N)ccc1C2c1ccccc1C(=O)O
InChIInChI=1S/C20H16N2O3/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24/h1-10,19H,21-22H2,(H,23,24)
InChIKeyBVXJAFUXNGEVOW-UHFFFAOYSA-N
MW332.36 g/mol
LogP3.84
Rot. Bonds2

About 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid

2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid (PubChem CID 57261742) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid.

Molecular Properties

Compound Name2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid
PubChem CID57261742
Molecular FormulaC20H16N2O3
Molecular Weight332.36 g/mol
Exact Mass332.12
IUPAC Name2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid
SMILESNc1ccc2c(c1)Oc1cc(N)ccc1C2c1ccccc1C(=O)O
InChIInChI=1S/C20H16N2O3/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24/h1-10,19H,21-22H2,(H,23,24)
InChIKeyBVXJAFUXNGEVOW-UHFFFAOYSA-N
XLogP3.84
TPSA98.57 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.36
LogP ≤ 53.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
The IUPAC name of 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid (CID 57261742) is 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid.
What is the SMILES notation for 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
The canonical SMILES for 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid is Nc1ccc2c(c1)Oc1cc(N)ccc1C2c1ccccc1C(=O)O.
What is the InChIKey of 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
The InChIKey is BVXJAFUXNGEVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O3/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24/h1-10,19H,21-22H2,(H,23,24).
What are the key properties of 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid has a molecular weight of 332.36 g/mol, XLogP of 3.84, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid is sourced from PubChem (CID 57261742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).