C8H12F3N3O2S2 — CID 57261786
1,1,1-trifluoro-N-[4-(1H-imidazol-2-yl)-4-sulfanylbutyl]methanesulfonamide (PubChem CID 57261786) has the molecular formula C8H12F3N3O2S2 and a molecular weight of 303.33 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[4-(1H-imidazol-2-yl)-4-sulfanylbutyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[4-(1H-imidazol-2-yl)-4-sulfanylbutyl]methanesulfonamide |
|---|---|
| PubChem CID | 57261786 |
| Molecular Formula | C8H12F3N3O2S2 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1,1,1-trifluoro-N-[4-(1H-imidazol-2-yl)-4-sulfanylbutyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCCC(S)c1ncc[nH]1)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O2S2/c9-8(10,11)18(15,16)14-3-1-2-6(17)7-12-4-5-13-7/h4-6,14,17H,1-3H2,(H,12,13) |
| InChIKey | JOWRSPIIXZSEEL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|