C36H51F5O6S — CID 57262262
[(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 57262262) has the molecular formula C36H51F5O6S and a molecular weight of 706.85 g/mol. Its IUPAC name is [(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 57262262 |
| Molecular Formula | C36H51F5O6S |
| Molecular Weight | 706.85 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | [(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C[C@@H](CCCCCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C36H51F5O6S/c1-24(42)46-28-13-14-29-27(23-28)22-26(33-30(29)17-19-34(3)31(33)15-16-32(34)47-25(2)43)12-9-7-5-4-6-8-10-20-48(44,45)21-11-18-35(37,38)36(39,40)41/h13-14,23,26,30-33H,4-12,15-22H2,1-3H3/t26-,30-,31+,32+,33-,34+/m1/s1 |
| InChIKey | OMECGAIKGGDHDT-XSPJCTAZSA-N |
| XLogP | 9.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.85 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|