About 5,5-dibromocyclohex-2-ene-1,4-dione
5,5-dibromocyclohex-2-ene-1,4-dione (PubChem CID 57262694) has the molecular formula C6H4Br2O2
and a molecular weight of 267.90 g/mol. Its IUPAC name is 5,5-dibromocyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 5,5-dibromocyclohex-2-ene-1,4-dione |
| PubChem CID | 57262694 |
| Molecular Formula | C6H4Br2O2 |
| Molecular Weight | 267.90 g/mol |
| Exact Mass | 265.86 |
| IUPAC Name | 5,5-dibromocyclohex-2-ene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(Br)(Br)C1 |
| InChI | InChI=1S/C6H4Br2O2/c7-6(8)3-4(9)1-2-5(6)10/h1-2H,3H2 |
| InChIKey | FHCGYEXIOGIDEC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.90 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibromocyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibromocyclohex-2-ene-1,4-dione?
The IUPAC name of 5,5-dibromocyclohex-2-ene-1,4-dione (CID 57262694) is 5,5-dibromocyclohex-2-ene-1,4-dione.
What is the SMILES notation for 5,5-dibromocyclohex-2-ene-1,4-dione?
The canonical SMILES for 5,5-dibromocyclohex-2-ene-1,4-dione is O=C1C=CC(=O)C(Br)(Br)C1.
What is the InChIKey of 5,5-dibromocyclohex-2-ene-1,4-dione?
The InChIKey is FHCGYEXIOGIDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2O2/c7-6(8)3-4(9)1-2-5(6)10/h1-2H,3H2.
What are the key properties of 5,5-dibromocyclohex-2-ene-1,4-dione?
5,5-dibromocyclohex-2-ene-1,4-dione has a molecular weight of 267.90 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibromocyclohex-2-ene-1,4-dione is sourced from PubChem (CID 57262694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).