C22H24O5 — CID 57262740
10,10,16,17-tetramethyl-6-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11,16-pentaene-4,18-dione (PubChem CID 57262740) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 10,10,16,17-tetramethyl-6-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11,16-pentaene-4,18-dione.
| Compound Name | 10,10,16,17-tetramethyl-6-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11,16-pentaene-4,18-dione |
|---|---|
| PubChem CID | 57262740 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 10,10,16,17-tetramethyl-6-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11,16-pentaene-4,18-dione |
| SMILES | CCCC1=CC(=O)OC2c3c(oc(C)c(C)c3=O)C3=C(OC(C)(C)C=C3)C12 |
| InChI | InChI=1S/C22H24O5/c1-6-7-13-10-15(23)26-21-16(13)20-14(8-9-22(4,5)27-20)19-17(21)18(24)11(2)12(3)25-19/h8-10,16,21H,6-7H2,1-5H3 |
| InChIKey | YGCJSCUYQMQIQU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |