C30H44O5S — CID 57263127
9-(benzenesulfonyl)-8-(2-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienal (PubChem CID 57263127) has the molecular formula C30H44O5S and a molecular weight of 516.74 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-8-(2-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienal.
| Compound Name | 9-(benzenesulfonyl)-8-(2-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienal |
|---|---|
| PubChem CID | 57263127 |
| Molecular Formula | C30H44O5S |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 9-(benzenesulfonyl)-8-(2-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienal |
| SMILES | CCOCCOC(C(C)=CCCC(C)=CC=O)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H44O5S/c1-7-34-21-22-35-28(25(4)14-11-13-23(2)18-20-31)29(27-24(3)15-12-19-30(27,5)6)36(32,33)26-16-9-8-10-17-26/h8-10,14,16-18,20,28-29H,7,11-13,15,19,21-22H2,1-6H3 |
| InChIKey | WHAFSZVJJWHPBB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|