C15H19F3N8O — CID 57263666
N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-1H-imidazole-2-carboxamide (PubChem CID 57263666) has the molecular formula C15H19F3N8O and a molecular weight of 384.37 g/mol. Its IUPAC name is N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-1H-imidazole-2-carboxamide.
| Compound Name | N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 57263666 |
| Molecular Formula | C15H19F3N8O |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-1H-imidazole-2-carboxamide |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(CCCCNC(=O)c2ncc[nH]2)n1 |
| InChI | InChI=1S/C15H19F3N8O/c16-15(17,18)9-24-14(19)26-11-4-6-20-10(25-11)3-1-2-5-23-13(27)12-21-7-8-22-12/h4,6-8H,1-3,5,9H2,(H,21,22)(H,23,27)(H3,19,20,24,25,26) |
| InChIKey | XAZCEUZGVJOPBI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|