C11H14N2 — CID 57263876
7,7-dimethyl-1,6-dihydro-1,4-benzodiazepine (PubChem CID 57263876) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 7,7-dimethyl-1,6-dihydro-1,4-benzodiazepine.
| Compound Name | 7,7-dimethyl-1,6-dihydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 57263876 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 7,7-dimethyl-1,6-dihydro-1,4-benzodiazepine |
| SMILES | CC1(C)C=CC2=C(C=NC=CN2)C1 |
| InChI | InChI=1S/C11H14N2/c1-11(2)4-3-10-9(7-11)8-12-5-6-13-10/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | GCSPKRHWJHWIAD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |