About 3,3-diiodopropanimidamide
3,3-diiodopropanimidamide (PubChem CID 57264007) has the molecular formula C3H6I2N2
and a molecular weight of 323.90 g/mol. Its IUPAC name is 3,3-diiodopropanimidamide.
Molecular Properties
| Compound Name | 3,3-diiodopropanimidamide |
| PubChem CID | 57264007 |
| Molecular Formula | C3H6I2N2 |
| Molecular Weight | 323.90 g/mol |
| Exact Mass | 323.86 |
| IUPAC Name | 3,3-diiodopropanimidamide |
| SMILES | [H]/N=C(\N)CC(I)I |
| InChI | InChI=1S/C3H6I2N2/c4-2(5)1-3(6)7/h2H,1H2,(H3,6,7) |
| InChIKey | SIZMOBLVSHVUPH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.90 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diiodopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diiodopropanimidamide?
The IUPAC name of 3,3-diiodopropanimidamide (CID 57264007) is 3,3-diiodopropanimidamide.
What is the SMILES notation for 3,3-diiodopropanimidamide?
The canonical SMILES for 3,3-diiodopropanimidamide is [H]/N=C(\N)CC(I)I.
What is the InChIKey of 3,3-diiodopropanimidamide?
The InChIKey is SIZMOBLVSHVUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6I2N2/c4-2(5)1-3(6)7/h2H,1H2,(H3,6,7).
What are the key properties of 3,3-diiodopropanimidamide?
3,3-diiodopropanimidamide has a molecular weight of 323.90 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diiodopropanimidamide is sourced from PubChem (CID 57264007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).