C8H6F12O — CID 57264302
1,1,1,3,3,3-hexafluoro-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]methyl]propane (PubChem CID 57264302) has the molecular formula C8H6F12O and a molecular weight of 346.11 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]methyl]propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]methyl]propane |
|---|---|
| PubChem CID | 57264302 |
| Molecular Formula | C8H6F12O |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]methyl]propane |
| SMILES | FC(F)(F)C(COCC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F12O/c9-5(10,11)3(6(12,13)14)1-21-2-4(7(15,16)17)8(18,19)20/h3-4H,1-2H2 |
| InChIKey | FNZYZFPVCVCAFA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |