About 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide
5-phenyl-N'-propan-2-ylfuran-3-carboximidamide (PubChem CID 57264324) has the molecular formula C14H16N2O
and a molecular weight of 228.30 g/mol. Its IUPAC name is 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide.
Molecular Properties
| Compound Name | 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide |
| PubChem CID | 57264324 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1coc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H16N2O/c1-10(2)16-14(15)12-8-13(17-9-12)11-6-4-3-5-7-11/h3-10H,1-2H3,(H2,15,16) |
| InChIKey | GTWDKJVLLVLWQA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide?
The IUPAC name of 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide (CID 57264324) is 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide.
What is the SMILES notation for 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide?
The canonical SMILES for 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide is CC(C)/N=C(\N)c1coc(-c2ccccc2)c1.
What is the InChIKey of 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide?
The InChIKey is GTWDKJVLLVLWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O/c1-10(2)16-14(15)12-8-13(17-9-12)11-6-4-3-5-7-11/h3-10H,1-2H3,(H2,15,16).
What are the key properties of 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide?
5-phenyl-N'-propan-2-ylfuran-3-carboximidamide has a molecular weight of 228.30 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-N'-propan-2-ylfuran-3-carboximidamide is sourced from PubChem (CID 57264324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).