About 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole
1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole (PubChem CID 57264340) has the molecular formula C24H30N4O3
and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole.
Molecular Properties
| Compound Name | 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole |
| PubChem CID | 57264340 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole |
| SMILES | CCOc1ccc2c(c1)ncn2CCCN1CCN(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C24H30N4O3/c1-2-29-20-5-6-22-21(17-20)25-18-28(22)9-3-8-26-10-12-27(13-11-26)19-4-7-23-24(16-19)31-15-14-30-23/h4-7,16-18H,2-3,8-15H2,1H3 |
| InChIKey | AFSJVVHGATZHDY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole?
The IUPAC name of 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole (CID 57264340) is 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole.
What is the SMILES notation for 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole?
The canonical SMILES for 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole is CCOc1ccc2c(c1)ncn2CCCN1CCN(c2ccc3c(c2)OCCO3)CC1.
What is the InChIKey of 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole?
The InChIKey is AFSJVVHGATZHDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O3/c1-2-29-20-5-6-22-21(17-20)25-18-28(22)9-3-8-26-10-12-27(13-11-26)19-4-7-23-24(16-19)31-15-14-30-23/h4-7,16-18H,2-3,8-15H2,1H3.
What are the key properties of 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole?
1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole has a molecular weight of 422.53 g/mol, XLogP of 3.42, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-5-ethoxybenzimidazole is sourced from PubChem (CID 57264340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).