C21H35N3O5S2Si — CID 57264713
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(methyldisulfanyl)carbonyloxy-(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 57264713) has the molecular formula C21H35N3O5S2Si and a molecular weight of 501.75 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(methyldisulfanyl)carbonyloxy-(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(methyldisulfanyl)carbonyloxy-(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57264713 |
| Molecular Formula | C21H35N3O5S2Si |
| Molecular Weight | 501.75 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(methyldisulfanyl)carbonyloxy-(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(OC(=O)SSC)c1ccnn1C |
| InChI | InChI=1S/C21H35N3O5S2Si/c1-9-12-27-19(25)24-14-15(29-32(7,8)21(2,3)4)13-17(24)18(28-20(26)31-30-6)16-10-11-22-23(16)5/h9-11,15,17-18H,1,12-14H2,2-8H3/t15-,17+,18?/m1/s1 |
| InChIKey | XJUCZSHGGSSRKX-OEQNEYKNSA-N |
| XLogP | 5.40 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.75 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|