About [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate
[3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate (PubChem CID 57264878) has the molecular formula C26H32N2O4
and a molecular weight of 436.55 g/mol. Its IUPAC name is [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate.
Molecular Properties
| Compound Name | [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate |
| PubChem CID | 57264878 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate |
| SMILES | CC(C)C(=O)CC(=O)ONC(=O)CCN1CCC(c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N2O4/c1-20(2)23(29)19-25(31)32-27-24(30)13-16-28-17-14-26(15-18-28,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,20H,13-19H2,1-2H3,(H,27,30) |
| InChIKey | SQFRARGZBWSBMX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate?
The IUPAC name of [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate (CID 57264878) is [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate.
What is the SMILES notation for [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate?
The canonical SMILES for [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate is CC(C)C(=O)CC(=O)ONC(=O)CCN1CCC(c2ccccc2)(c2ccccc2)CC1.
What is the InChIKey of [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate?
The InChIKey is SQFRARGZBWSBMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O4/c1-20(2)23(29)19-25(31)32-27-24(30)13-16-28-17-14-26(15-18-28,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,20H,13-19H2,1-2H3,(H,27,30).
What are the key properties of [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate?
[3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate has a molecular weight of 436.55 g/mol, XLogP of 3.65, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4,4-diphenylpiperidin-1-yl)propanoylamino] 4-methyl-3-oxopentanoate is sourced from PubChem (CID 57264878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).