About dodeca-2,4-dienamide
dodeca-2,4-dienamide (PubChem CID 57265506) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is dodeca-2,4-dienamide.
Molecular Properties
| Compound Name | dodeca-2,4-dienamide |
| PubChem CID | 57265506 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | dodeca-2,4-dienamide |
| SMILES | CCCCCCCC=CC=CC(N)=O |
| InChI | InChI=1S/C12H21NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h8-11H,2-7H2,1H3,(H2,13,14) |
| InChIKey | ZJDVIVOFURPUPP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dodeca-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodeca-2,4-dienamide?
The IUPAC name of dodeca-2,4-dienamide (CID 57265506) is dodeca-2,4-dienamide.
What is the SMILES notation for dodeca-2,4-dienamide?
The canonical SMILES for dodeca-2,4-dienamide is CCCCCCCC=CC=CC(N)=O.
What is the InChIKey of dodeca-2,4-dienamide?
The InChIKey is ZJDVIVOFURPUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h8-11H,2-7H2,1H3,(H2,13,14).
What are the key properties of dodeca-2,4-dienamide?
dodeca-2,4-dienamide has a molecular weight of 195.31 g/mol, XLogP of 2.94, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodeca-2,4-dienamide is sourced from PubChem (CID 57265506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).