C27H36N4O2 — CID 57265641
3-[1-[5-[2-(hydroxymethyl)-5-methylpyrrolidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]benzenecarboximidamide (PubChem CID 57265641) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 3-[1-[5-[2-(hydroxymethyl)-5-methylpyrrolidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]benzenecarboximidamide.
| Compound Name | 3-[1-[5-[2-(hydroxymethyl)-5-methylpyrrolidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 57265641 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 3-[1-[5-[2-(hydroxymethyl)-5-methylpyrrolidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2Cc3ccccc3N(CCCCCN3C(C)CCC3CO)C2=O)c1 |
| InChI | InChI=1S/C27H36N4O2/c1-19-12-13-23(18-32)30(19)14-5-2-6-15-31-25-11-4-3-8-21(25)17-24(27(31)33)20-9-7-10-22(16-20)26(28)29/h3-4,7-11,16,19,23-24,32H,2,5-6,12-15,17-18H2,1H3,(H3,28,29) |
| InChIKey | DEGCQJVPQYDWMR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|