About 3-purin-9-ylprop-2-enal
3-purin-9-ylprop-2-enal (PubChem CID 57265796) has the molecular formula C8H6N4O
and a molecular weight of 174.16 g/mol. Its IUPAC name is 3-purin-9-ylprop-2-enal.
Molecular Properties
| Compound Name | 3-purin-9-ylprop-2-enal |
| PubChem CID | 57265796 |
| Molecular Formula | C8H6N4O |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3-purin-9-ylprop-2-enal |
| SMILES | O=CC=Cn1cnc2cncnc21 |
| InChI | InChI=1S/C8H6N4O/c13-3-1-2-12-6-11-7-4-9-5-10-8(7)12/h1-6H |
| InChIKey | ZGUAPYVQRZPXRE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-purin-9-ylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-purin-9-ylprop-2-enal?
The IUPAC name of 3-purin-9-ylprop-2-enal (CID 57265796) is 3-purin-9-ylprop-2-enal.
What is the SMILES notation for 3-purin-9-ylprop-2-enal?
The canonical SMILES for 3-purin-9-ylprop-2-enal is O=CC=Cn1cnc2cncnc21.
What is the InChIKey of 3-purin-9-ylprop-2-enal?
The InChIKey is ZGUAPYVQRZPXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O/c13-3-1-2-12-6-11-7-4-9-5-10-8(7)12/h1-6H.
What are the key properties of 3-purin-9-ylprop-2-enal?
3-purin-9-ylprop-2-enal has a molecular weight of 174.16 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-purin-9-ylprop-2-enal is sourced from PubChem (CID 57265796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).