C20H22N6O2 — CID 57265869
(3R)-3-[4-(4-quinoxalin-2-ylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid (PubChem CID 57265869) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is (3R)-3-[4-(4-quinoxalin-2-ylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid.
| Compound Name | (3R)-3-[4-(4-quinoxalin-2-ylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 57265869 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (3R)-3-[4-(4-quinoxalin-2-ylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid |
| SMILES | C[C@H](CC(=O)O)c1nccc(N2CCN(c3cnc4ccccc4n3)CC2)n1 |
| InChI | InChI=1S/C20H22N6O2/c1-14(12-19(27)28)20-21-7-6-17(24-20)25-8-10-26(11-9-25)18-13-22-15-4-2-3-5-16(15)23-18/h2-7,13-14H,8-12H2,1H3,(H,27,28)/t14-/m1/s1 |
| InChIKey | VIIPZEKJVIFVGU-CQSZACIVSA-N |
| XLogP | 2.32 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |