C18H14Cl4N4O2 — CID 57265894
3-methyl-1-phenyl-5-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]iminoimidazolidine-2,4-dione (PubChem CID 57265894) has the molecular formula C18H14Cl4N4O2 and a molecular weight of 460.15 g/mol. Its IUPAC name is 3-methyl-1-phenyl-5-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]iminoimidazolidine-2,4-dione.
| Compound Name | 3-methyl-1-phenyl-5-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]iminoimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57265894 |
| Molecular Formula | C18H14Cl4N4O2 |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 3-methyl-1-phenyl-5-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]iminoimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=NC(Nc2ccc(Cl)cc2)C(Cl)(Cl)Cl)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H14Cl4N4O2/c1-25-15(27)14(26(17(25)28)13-5-3-2-4-6-13)24-16(18(20,21)22)23-12-9-7-11(19)8-10-12/h2-10,16,23H,1H3 |
| InChIKey | MONBXHNXTHLWHQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|