About 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one
5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one (PubChem CID 57266371) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one |
| PubChem CID | 57266371 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one |
| SMILES | CCC(=O)C1=C(OC)C(=O)NCC1 |
| InChI | InChI=1S/C9H13NO3/c1-3-7(11)6-4-5-10-9(12)8(6)13-2/h3-5H2,1-2H3,(H,10,12) |
| InChIKey | APHIPBNKHSJIRM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one?
The IUPAC name of 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one (CID 57266371) is 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one.
What is the SMILES notation for 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one?
The canonical SMILES for 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one is CCC(=O)C1=C(OC)C(=O)NCC1.
What is the InChIKey of 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one?
The InChIKey is APHIPBNKHSJIRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-3-7(11)6-4-5-10-9(12)8(6)13-2/h3-5H2,1-2H3,(H,10,12).
What are the key properties of 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one?
5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one has a molecular weight of 183.21 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4-propanoyl-2,3-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 57266371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).