C15H24N2O4S2 — CID 57266825
(4S,7S,9aS)-5-oxo-4-(2-sulfanylhexanoylamino)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid (PubChem CID 57266825) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (4S,7S,9aS)-5-oxo-4-(2-sulfanylhexanoylamino)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid.
| Compound Name | (4S,7S,9aS)-5-oxo-4-(2-sulfanylhexanoylamino)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid |
|---|---|
| PubChem CID | 57266825 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4S,7S,9aS)-5-oxo-4-(2-sulfanylhexanoylamino)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid |
| SMILES | CCCCC(S)C(=O)N[C@H]1CCS[C@H]2CC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C15H24N2O4S2/c1-2-3-4-11(22)13(18)16-9-7-8-23-12-6-5-10(15(20)21)17(12)14(9)19/h9-12,22H,2-8H2,1H3,(H,16,18)(H,20,21)/t9-,10-,11?,12-/m0/s1 |
| InChIKey | KLOFMYPWIWDNHR-NTUYEHIUSA-N |
| XLogP | 1.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|