C13H22F4N2O2+2 — CID 57267265
(1,3-dibutyl-2-fluoro-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate (PubChem CID 57267265) has the molecular formula C13H22F4N2O2+2 and a molecular weight of 314.32 g/mol. Its IUPAC name is (1,3-dibutyl-2-fluoro-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate.
| Compound Name | (1,3-dibutyl-2-fluoro-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57267265 |
| Molecular Formula | C13H22F4N2O2+2 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (1,3-dibutyl-2-fluoro-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate |
| SMILES | CCCC[N+]1=C(F)[N+](CCCC)(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F4N2O2/c1-3-5-7-18-8-10-19(12(18)14,9-6-4-2)21-11(20)13(15,16)17/h3-10H2,1-2H3/q+2 |
| InChIKey | NBJBAVVNJMOFSF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|