About 4,5-dihydroimidazol-1-yl dihydrogen phosphite
4,5-dihydroimidazol-1-yl dihydrogen phosphite (PubChem CID 57267775) has the molecular formula C3H7N2O3P
and a molecular weight of 150.07 g/mol. Its IUPAC name is 4,5-dihydroimidazol-1-yl dihydrogen phosphite.
Molecular Properties
| Compound Name | 4,5-dihydroimidazol-1-yl dihydrogen phosphite |
| PubChem CID | 57267775 |
| Molecular Formula | C3H7N2O3P |
| Molecular Weight | 150.07 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | 4,5-dihydroimidazol-1-yl dihydrogen phosphite |
| SMILES | OP(O)ON1C=NCC1 |
| InChI | InChI=1S/C3H7N2O3P/c6-9(7)8-5-2-1-4-3-5/h3,6-7H,1-2H2 |
| InChIKey | CYGJGASNAHVOEJ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.07 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroimidazol-1-yl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroimidazol-1-yl dihydrogen phosphite?
The IUPAC name of 4,5-dihydroimidazol-1-yl dihydrogen phosphite (CID 57267775) is 4,5-dihydroimidazol-1-yl dihydrogen phosphite.
What is the SMILES notation for 4,5-dihydroimidazol-1-yl dihydrogen phosphite?
The canonical SMILES for 4,5-dihydroimidazol-1-yl dihydrogen phosphite is OP(O)ON1C=NCC1.
What is the InChIKey of 4,5-dihydroimidazol-1-yl dihydrogen phosphite?
The InChIKey is CYGJGASNAHVOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N2O3P/c6-9(7)8-5-2-1-4-3-5/h3,6-7H,1-2H2.
What are the key properties of 4,5-dihydroimidazol-1-yl dihydrogen phosphite?
4,5-dihydroimidazol-1-yl dihydrogen phosphite has a molecular weight of 150.07 g/mol, XLogP of -0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroimidazol-1-yl dihydrogen phosphite is sourced from PubChem (CID 57267775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).