About hexan-3-yl hydrogen sulfite
hexan-3-yl hydrogen sulfite (PubChem CID 57267799) has the molecular formula C6H14O3S
and a molecular weight of 166.24 g/mol. Its IUPAC name is hexan-3-yl hydrogen sulfite.
Molecular Properties
| Compound Name | hexan-3-yl hydrogen sulfite |
| PubChem CID | 57267799 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | hexan-3-yl hydrogen sulfite |
| SMILES | CCCC(CC)OS(=O)O |
| InChI | InChI=1S/C6H14O3S/c1-3-5-6(4-2)9-10(7)8/h6H,3-5H2,1-2H3,(H,7,8) |
| InChIKey | FZGQMKIPZLXKKF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hexan-3-yl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-yl hydrogen sulfite?
The IUPAC name of hexan-3-yl hydrogen sulfite (CID 57267799) is hexan-3-yl hydrogen sulfite.
What is the SMILES notation for hexan-3-yl hydrogen sulfite?
The canonical SMILES for hexan-3-yl hydrogen sulfite is CCCC(CC)OS(=O)O.
What is the InChIKey of hexan-3-yl hydrogen sulfite?
The InChIKey is FZGQMKIPZLXKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3S/c1-3-5-6(4-2)9-10(7)8/h6H,3-5H2,1-2H3,(H,7,8).
What are the key properties of hexan-3-yl hydrogen sulfite?
hexan-3-yl hydrogen sulfite has a molecular weight of 166.24 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-yl hydrogen sulfite is sourced from PubChem (CID 57267799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).