About (5-propyl-1,2,4-triazol-3-ylidene)azanium
(5-propyl-1,2,4-triazol-3-ylidene)azanium (PubChem CID 57267840) has the molecular formula C5H9N4+
and a molecular weight of 125.15 g/mol. Its IUPAC name is (5-propyl-1,2,4-triazol-3-ylidene)azanium.
Molecular Properties
| Compound Name | (5-propyl-1,2,4-triazol-3-ylidene)azanium |
| PubChem CID | 57267840 |
| Molecular Formula | C5H9N4+ |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (5-propyl-1,2,4-triazol-3-ylidene)azanium |
| SMILES | CCCC1=NC(=[NH2+])N=N1 |
| InChI | InChI=1S/C5H8N4/c1-2-3-4-7-5(6)9-8-4/h6H,2-3H2,1H3/p+1 |
| InChIKey | SQLACWPEHICPIJ-UHFFFAOYSA-O |
| XLogP | -0.23 |
| TPSA | 62.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5-propyl-1,2,4-triazol-3-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propyl-1,2,4-triazol-3-ylidene)azanium?
The IUPAC name of (5-propyl-1,2,4-triazol-3-ylidene)azanium (CID 57267840) is (5-propyl-1,2,4-triazol-3-ylidene)azanium.
What is the SMILES notation for (5-propyl-1,2,4-triazol-3-ylidene)azanium?
The canonical SMILES for (5-propyl-1,2,4-triazol-3-ylidene)azanium is CCCC1=NC(=[NH2+])N=N1.
What is the InChIKey of (5-propyl-1,2,4-triazol-3-ylidene)azanium?
The InChIKey is SQLACWPEHICPIJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H8N4/c1-2-3-4-7-5(6)9-8-4/h6H,2-3H2,1H3/p+1.
What are the key properties of (5-propyl-1,2,4-triazol-3-ylidene)azanium?
(5-propyl-1,2,4-triazol-3-ylidene)azanium has a molecular weight of 125.15 g/mol, XLogP of -0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propyl-1,2,4-triazol-3-ylidene)azanium is sourced from PubChem (CID 57267840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).