C13H17NO — CID 57268068
3,6,7,7a,10,11,11a,11b-octahydropyrrolo[2,1-a][2]benzazepin-5-one (PubChem CID 57268068) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 3,6,7,7a,10,11,11a,11b-octahydropyrrolo[2,1-a][2]benzazepin-5-one.
| Compound Name | 3,6,7,7a,10,11,11a,11b-octahydropyrrolo[2,1-a][2]benzazepin-5-one |
|---|---|
| PubChem CID | 57268068 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3,6,7,7a,10,11,11a,11b-octahydropyrrolo[2,1-a][2]benzazepin-5-one |
| SMILES | O=C1CCC2C=CCCC2C2C=CCN12 |
| InChI | InChI=1S/C13H17NO/c15-13-8-7-10-4-1-2-5-11(10)12-6-3-9-14(12)13/h1,3-4,6,10-12H,2,5,7-9H2 |
| InChIKey | PAQSMNXDUSZGGX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|