About 1-morpholin-4-ylpenta-3,4-dien-1-one
1-morpholin-4-ylpenta-3,4-dien-1-one (PubChem CID 57268206) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-morpholin-4-ylpenta-3,4-dien-1-one.
Molecular Properties
| Compound Name | 1-morpholin-4-ylpenta-3,4-dien-1-one |
| PubChem CID | 57268206 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-morpholin-4-ylpenta-3,4-dien-1-one |
| SMILES | C=C=CCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C9H13NO2/c1-2-3-4-9(11)10-5-7-12-8-6-10/h3H,1,4-8H2 |
| InChIKey | DGOPQMFYJGIPMM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-morpholin-4-ylpenta-3,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylpenta-3,4-dien-1-one?
The IUPAC name of 1-morpholin-4-ylpenta-3,4-dien-1-one (CID 57268206) is 1-morpholin-4-ylpenta-3,4-dien-1-one.
What is the SMILES notation for 1-morpholin-4-ylpenta-3,4-dien-1-one?
The canonical SMILES for 1-morpholin-4-ylpenta-3,4-dien-1-one is C=C=CCC(=O)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-ylpenta-3,4-dien-1-one?
The InChIKey is DGOPQMFYJGIPMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-2-3-4-9(11)10-5-7-12-8-6-10/h3H,1,4-8H2.
What are the key properties of 1-morpholin-4-ylpenta-3,4-dien-1-one?
1-morpholin-4-ylpenta-3,4-dien-1-one has a molecular weight of 167.21 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylpenta-3,4-dien-1-one is sourced from PubChem (CID 57268206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).