About 2-ethoxypentanal
2-ethoxypentanal (PubChem CID 57268596) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-ethoxypentanal.
Molecular Properties
| Compound Name | 2-ethoxypentanal |
| PubChem CID | 57268596 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-ethoxypentanal |
| SMILES | CCCC(C=O)OCC |
| InChI | InChI=1S/C7H14O2/c1-3-5-7(6-8)9-4-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | FSCDRCREBXGSQM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypentanal?
The IUPAC name of 2-ethoxypentanal (CID 57268596) is 2-ethoxypentanal.
What is the SMILES notation for 2-ethoxypentanal?
The canonical SMILES for 2-ethoxypentanal is CCCC(C=O)OCC.
What is the InChIKey of 2-ethoxypentanal?
The InChIKey is FSCDRCREBXGSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-5-7(6-8)9-4-2/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-ethoxypentanal?
2-ethoxypentanal has a molecular weight of 130.19 g/mol, XLogP of 1.39, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypentanal is sourced from PubChem (CID 57268596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).