C25H35NO5 — CID 57268775
ethyl 2-formamido-2-[(8S,9R,10S,13S,14S)-9-hydroxy-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetate (PubChem CID 57268775) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl 2-formamido-2-[(8S,9R,10S,13S,14S)-9-hydroxy-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetate.
| Compound Name | ethyl 2-formamido-2-[(8S,9R,10S,13S,14S)-9-hydroxy-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetate |
|---|---|
| PubChem CID | 57268775 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | ethyl 2-formamido-2-[(8S,9R,10S,13S,14S)-9-hydroxy-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetate |
| SMILES | CCOC(=O)C(NC=O)=C1CC[C@H]2[C@@H]3CC=C4C=C(OC)CC[C@]4(C)[C@@]3(O)CC[C@]12C |
| InChI | InChI=1S/C25H35NO5/c1-5-31-22(28)21(26-15-27)20-9-8-18-19-7-6-16-14-17(30-4)10-11-24(16,3)25(19,29)13-12-23(18,20)2/h6,14-15,18-19,29H,5,7-13H2,1-4H3,(H,26,27)/t18-,19-,23-,24-,25+/m0/s1 |
| InChIKey | SIGVKPAIRRIEFB-QBXOAZQASA-N |
| XLogP | 3.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|