About [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate
[4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate (PubChem CID 57269249) has the molecular formula C17H21N3O5
and a molecular weight of 347.37 g/mol. Its IUPAC name is [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate.
Molecular Properties
| Compound Name | [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate |
| PubChem CID | 57269249 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate |
| SMILES | CCON=Cc1ccc(C2(C)C(=O)N(OC(=O)CC)C(=O)N2C)cc1 |
| InChI | InChI=1S/C17H21N3O5/c1-5-14(21)25-20-15(22)17(3,19(4)16(20)23)13-9-7-12(8-10-13)11-18-24-6-2/h7-11H,5-6H2,1-4H3 |
| InChIKey | JDLZYGQXJHYJLW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate?
The IUPAC name of [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate (CID 57269249) is [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate.
What is the SMILES notation for [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate?
The canonical SMILES for [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate is CCON=Cc1ccc(C2(C)C(=O)N(OC(=O)CC)C(=O)N2C)cc1.
What is the InChIKey of [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate?
The InChIKey is JDLZYGQXJHYJLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O5/c1-5-14(21)25-20-15(22)17(3,19(4)16(20)23)13-9-7-12(8-10-13)11-18-24-6-2/h7-11H,5-6H2,1-4H3.
What are the key properties of [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate?
[4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate has a molecular weight of 347.37 g/mol, XLogP of 2.03, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl] propanoate is sourced from PubChem (CID 57269249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).